643-28-7 2-Isopropylaniline
termék neve |
2-Isopropylaniline |
Angol név |
2-Isopropylaniline; 2-Aminocumene; 2-(1-methylethyl)-benzenamine; 2-(propan-2-yl)aniline |
MF |
C9H13N |
Molekulatömeg |
135.2062 |
InChI |
InChI=1/C9H13N/c1-7(2)8-5-3-4-6-9(8)10/h3-7H,10H2,1-2H3 |
CAS-szám |
643-28-7 |
EINECS |
211-397-7 |
Molekuláris szerkezete |
|
Sűrűség |
0.953g/cm3 |
Forráspont |
225.6°C at 760 mmHg |
Törésmutató |
1.542 |
Gyulladáspont |
95.6°C |
Gőznyomás |
0.0858mmHg at 25°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|