ChemNet > CAS > 64779-10-8 4-(4-octylphenyl)-4-oxobutanoic acid
64779-10-8 4-(4-octylphenyl)-4-oxobutanoic acid
termék neve |
4-(4-octylphenyl)-4-oxobutanoic acid |
Angol név |
4-(4-octylphenyl)-4-oxobutanoic acid; |
MF |
C18H26O3 |
Molekulatömeg |
290.3972 |
InChI |
InChI=1/C18H26O3/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)17(19)13-14-18(20)21/h9-12H,2-8,13-14H2,1H3,(H,20,21) |
CAS-szám |
64779-10-8 |
Molekuláris szerkezete |
|
Sűrűség |
1.035g/cm3 |
Olvadáspont |
91℃ |
Forráspont |
463.4°C at 760 mmHg |
Törésmutató |
1.514 |
Gyulladáspont |
248.2°C |
Gőznyomás |
2.2E-09mmHg at 25°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|