ChemNet > CAS > 6590-95-0 2,6-Dichlorophenyl isothiocyanate
6590-95-0 2,6-Dichlorophenyl isothiocyanate
| termék neve |
2,6-Dichlorophenyl isothiocyanate |
| Angol név |
2,6-Dichlorophenyl isothiocyanate; 2,6-Dichloroisothiocyanatobenzene; 1,3-dichloro-2-isothiocyanatobenzene; 2,6-Dichloro Phenyl Isothiocynate |
| MF |
C7H3Cl2NS |
| Molekulatömeg |
204.0764 |
| InChI |
InChI=1/C7H3Cl2NS/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
| CAS-szám |
6590-95-0 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.37g/cm3 |
| Forráspont |
302.2°C at 760 mmHg |
| Törésmutató |
1.614 |
| Gyulladáspont |
136.5°C |
| Gőznyomás |
0.00181mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
