ChemNet > CAS > 6609-54-7 2-(Methylthio)benzonitrile
6609-54-7 2-(Methylthio)benzonitrile
termék neve |
2-(Methylthio)benzonitrile |
Angol név |
2-(Methylthio)benzonitrile; 2-Cyanothioanisole~2-(Methylmercapto)benzonitrile; 2-(methylsulfanyl)benzonitrile |
MF |
C8H7NS |
Molekulatömeg |
149.2129 |
InChI |
InChI=1/C8H7NS/c1-10-8-5-3-2-4-7(8)6-9/h2-5H,1H3 |
CAS-szám |
6609-54-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.14g/cm3 |
Forráspont |
263.9°C at 760 mmHg |
Törésmutató |
1.589 |
Gyulladáspont |
113.4°C |
Gőznyomás |
0.00999mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|