ChemNet > CAS > 67751-23-9 4-(dimethylamino)-1,1-dimethoxybut-3-en-2-one
67751-23-9 4-(dimethylamino)-1,1-dimethoxybut-3-en-2-one
| termék neve |
4-(dimethylamino)-1,1-dimethoxybut-3-en-2-one |
| Angol név |
4-(dimethylamino)-1,1-dimethoxybut-3-en-2-one; (3E)-4-(dimethylamino)-1,1-dimethoxybut-3-en-2-one; (3Z)-4-(dimethylamino)-1,1-dimethoxybut-3-en-2-one; 1,1-Dimethoxy-4-dimethylaminobut-3-en-2-one; (Z)-4-(Dimethylamino)-1,1-dimethoxybut-3-en-2-one |
| MF |
C8H15NO3 |
| Molekulatömeg |
173.2096 |
| InChI |
InChI=1/C8H15NO3/c1-9(2)6-5-7(10)8(11-3)12-4/h5-6,8H,1-4H3/b6-5- |
| CAS-szám |
67751-23-9 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.009g/cm3 |
| Forráspont |
211.238°C at 760 mmHg |
| Törésmutató |
1.453 |
| Gyulladáspont |
81.554°C |
| Gőznyomás |
0.184mmHg at 25°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
