ChemNet > CAS > 68295-45-4 (R)-(-)-2-(Anilinomethyl)pyrrolidine
68295-45-4 (R)-(-)-2-(Anilinomethyl)pyrrolidine
| termék neve |
(R)-(-)-2-(Anilinomethyl)pyrrolidine |
| Angol név |
(R)-(-)-2-(Anilinomethyl)pyrrolidine;N-[(2R)-pyrrolidin-2-ylmethyl]aniline |
| MF |
C11H16N2 |
| Molekulatömeg |
176.2581 |
| InChI |
InChI=1/C11H16N2/c1-2-5-10(6-3-1)13-9-11-7-4-8-12-11/h1-3,5-6,11-13H,4,7-9H2/t11-/m1/s1 |
| CAS-szám |
68295-45-4 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.038g/cm3 |
| Forráspont |
311°C at 760 mmHg |
| Törésmutató |
1.57 |
| Gyulladáspont |
184.3°C |
| Gőznyomás |
0.00058mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R34:Causes burns.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
