ChemNet > CAS > 68385-95-5 2-Amino-3,5-dibromobenzonitrile
68385-95-5 2-Amino-3,5-dibromobenzonitrile
| termék neve |
2-Amino-3,5-dibromobenzonitrile |
| Angol név |
2-Amino-3,5-dibromobenzonitrile; |
| MF |
C7H4Br2N2 |
| Molekulatömeg |
275.9281 |
| InChI |
InChI=1/C7H4Br2N2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-2H,11H2 |
| CAS-szám |
68385-95-5 |
| Molekuláris szerkezete |
|
| Sűrűség |
2.12g/cm3 |
| Olvadáspont |
160-163℃ |
| Forráspont |
301.2°C at 760 mmHg |
| Törésmutató |
1.704 |
| Gyulladáspont |
136°C |
| Gőznyomás |
0.00107mmHg at 25°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
