ChemNet > CAS > 69321-60-4 2,6-Dibromotoluene
69321-60-4 2,6-Dibromotoluene
| termék neve |
2,6-Dibromotoluene |
| Angol név |
2,6-Dibromotoluene; 1,3-dibromo-2-methylbenzene |
| MF |
C7H6Br2 |
| Molekulatömeg |
249.9305 |
| InChI |
InChI=1/C7H6Br2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| CAS-szám |
69321-60-4 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.81g/cm3 |
| Forráspont |
246°C at 760 mmHg |
| Törésmutató |
1.587 |
| Gyulladáspont |
106.6°C |
| Gőznyomás |
0.0436mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/38:Irritating to eyes and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
