ChemNet > CAS > 6950-92-1 2,4,6-Trimethylphenethylalcohol
6950-92-1 2,4,6-Trimethylphenethylalcohol
| termék neve |
2,4,6-Trimethylphenethylalcohol |
| Angol név |
2,4,6-Trimethylphenethylalcohol; 2-Mesitylethanol; 2-Hydroxyethylmesitylene~2,4,6-Trimethylphenethyl alcohol~2-(2,4,6-Trimethylphenyl)ethanol; 2-(2,4,6-trimethylphenyl)ethanol |
| MF |
C11H16O |
| Molekulatömeg |
164.2441 |
| InChI |
InChI=1/C11H16O/c1-8-6-9(2)11(4-5-12)10(3)7-8/h6-7,12H,4-5H2,1-3H3 |
| CAS-szám |
6950-92-1 |
| EINECS |
230-123-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
0.974g/cm3 |
| Forráspont |
290.7°C at 760 mmHg |
| Törésmutató |
1.526 |
| Gyulladáspont |
138.4°C |
| Gőznyomás |
0.000939mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|
