ChemNet > CAS > 7145-99-5 3,4-(metiléndioxi)toluol
7145-99-5 3,4-(metiléndioxi)toluol
| termék neve |
3,4-(metiléndioxi)toluol |
| Szinonimák |
5-metil-1,3-benzodioxol~1-metil-3,4-(metiléndioxi)benzol; 5-metil-1,3-benzodioxol |
| Angol név |
3,4-(Methylenedioxy)toluene; 5-Methyl-1,3-benzodioxole~1-Methyl-3,4-(methylenedioxy)benzene; 5-methyl-1,3-benzodioxole |
| MF |
C8H8O2 |
| Molekulatömeg |
136.1479 |
| InChI |
InChI=1/C8H8O2/c1-6-2-3-7-8(4-6)10-5-9-7/h2-4H,5H2,1H3 |
| CAS-szám |
7145-99-5 |
| EINECS |
230-453-1 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.164g/cm3 |
| Forráspont |
200.4°C at 760 mmHg |
| Törésmutató |
1.55 |
| Gyulladáspont |
76.1°C |
| Gőznyomás |
0.46mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
