ChemNet > CAS > 715-33-3 Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate
715-33-3 Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate
| termék neve |
Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate |
| Angol név |
Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate; 3,5-Dibromo-2,4-dihydroxy-6-methylbenzoic acid methyl ester |
| MF |
C9H8Br2O4 |
| Molekulatömeg |
339.9654 |
| InChI |
InChI=1/C9H8Br2O4/c1-3-4(9(14)15-2)7(12)6(11)8(13)5(3)10/h12-13H,1-2H3 |
| CAS-szám |
715-33-3 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.967g/cm3 |
| Forráspont |
307.4°C at 760 mmHg |
| Törésmutató |
1.636 |
| Gyulladáspont |
139.7°C |
| Gőznyomás |
0.0004mmHg at 25°C |
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|