71902-33-5 3,5-Difluoropyridine
termék neve |
3,5-Difluoropyridine |
Angol név |
3,5-Difluoropyridine; |
MF |
C5H3F2N |
Molekulatömeg |
115.0808 |
InChI |
InChI=1/C5H3F2N/c6-4-1-5(7)3-8-2-4/h1-3H |
CAS-szám |
71902-33-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.263g/cm3 |
Forráspont |
79.4°C at 760 mmHg |
Törésmutató |
1.446 |
Gyulladáspont |
1.9°C |
Gőznyomás |
98.5mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|