720-44-5 4-Methoxybenzhydrol
termék neve |
4-Methoxybenzhydrol |
Angol név |
4-Methoxybenzhydrol; 4-Methoxydiphenylmethanol~4-Methoxyphenyl phenyl carbinol; (4-methoxyphenyl)(phenyl)methanol |
MF |
C14H14O2 |
Molekulatömeg |
214.2598 |
InChI |
InChI=1/C14H14O2/c1-16-13-9-7-12(8-10-13)14(15)11-5-3-2-4-6-11/h2-10,14-15H,1H3 |
CAS-szám |
720-44-5 |
EINECS |
211-953-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.121g/cm3 |
Forráspont |
363.2°C at 760 mmHg |
Törésmutató |
1.582 |
Gyulladáspont |
164.5°C |
Gőznyomás |
6.55E-06mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|