ChemNet > CAS > 7209-11-2 1-(4-Bromo-2-thienyl)ethan-1-one
7209-11-2 1-(4-Bromo-2-thienyl)ethan-1-one
termék neve |
1-(4-Bromo-2-thienyl)ethan-1-one |
Angol név |
1-(4-Bromo-2-thienyl)ethan-1-one; 1-(4-bromothiophen-2-yl)ethanone; 4-bromo-2-acetylthiophene |
MF |
C6H5BrOS |
Molekulatömeg |
205.0723 |
InChI |
InChI=1/C6H5BrOS/c1-4(8)6-2-5(7)3-9-6/h2-3H,1H3 |
CAS-szám |
7209-11-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.619g/cm3 |
Forráspont |
284.4°C at 760 mmHg |
Törésmutató |
1.583 |
Gyulladáspont |
125.8°C |
Gőznyomás |
0.00299mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|