7355-22-8 5-Bromo-§
termék neve |
5-Bromo-§ |
Angol név |
5-Bromo-§ 5-Bromo-2,4-dihydroxybenzoic acid monohydrate; 5-bromo-2,4-dihydroxybenzoic acid |
MF |
C7H5BrO4 |
Molekulatömeg |
233.0162 |
InChI |
InChI=1/C7H5BrO4/c8-4-1-3(7(11)12)5(9)2-6(4)10/h1-2,9-10H,(H,11,12) |
CAS-szám |
7355-22-8 |
EINECS |
230-881-9 |
Molekuláris szerkezete |
|
Sűrűség |
2.026g/cm3 |
Forráspont |
436.7°C at 760 mmHg |
Törésmutató |
1.703 |
Gyulladáspont |
217.9°C |
Gőznyomás |
2.13E-08mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|