ChemNet > CAS > 738-66-9 N,N'-Bis(4-nitrophenyl)carbodiimide
738-66-9 N,N'-Bis(4-nitrophenyl)carbodiimide
termék neve |
N,N'-Bis(4-nitrophenyl)carbodiimide |
Angol név |
N,N'-Bis(4-nitrophenyl)carbodiimide; |
MF |
C13H8N4O4 |
Molekulatömeg |
284.227 |
InChI |
InChI=1/C13H8N4O4/c18-16(19)12-5-1-10(2-6-12)14-9-15-11-3-7-13(8-4-11)17(20)21/h1-8H |
CAS-szám |
738-66-9 |
EINECS |
212-005-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.38g/cm3 |
Olvadáspont |
166-168℃ |
Forráspont |
517.6°C at 760 mmHg |
Törésmutató |
1.649 |
Gyulladáspont |
266.8°C |
Gőznyomás |
2.66E-10mmHg at 25°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|