ChemNet > CAS > 7424-54-6 3,5-Heptanedione
7424-54-6 3,5-Heptanedione
| termék neve |
3,5-Heptanedione |
| Angol név |
3,5-Heptanedione; heptane-3,5-dione; (4Z)-5-hydroxyhept-4-en-3-one; 3,5-HEPTANDIONE |
| MF |
C7H12O2 |
| Molekulatömeg |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-3-6(8)5-7(9)4-2/h5,8H,3-4H2,1-2H3/b6-5- |
| CAS-szám |
7424-54-6 |
| EINECS |
231-054-5 |
| Molekuláris szerkezete |
|
| Sűrűség |
0.97g/cm3 |
| Forráspont |
216.1°C at 760 mmHg |
| Törésmutató |
1.456 |
| Gyulladáspont |
86.3°C |
| Gőznyomás |
0.0308mmHg at 25°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
