ChemNet > CAS > 7469-83-2 1-(4-Methoxyphenyl)-1-cyclohexanecarboxylic acid
7469-83-2 1-(4-Methoxyphenyl)-1-cyclohexanecarboxylic acid
| termék neve |
1-(4-Methoxyphenyl)-1-cyclohexanecarboxylic acid |
| Angol név |
1-(4-Methoxyphenyl)-1-cyclohexanecarboxylic acid; 2-(4-Chlorophenyl)-2-methylpropionic acid; 1-(4-methoxyphenyl)cyclohexanecarboxylic acid; 1-(4-methoxyphenyl)cyclohexanecarboxylate |
| MF |
C14H17O3 |
| Molekulatömeg |
233.2835 |
| InChI |
InChI=1/C14H18O3/c1-17-12-7-5-11(6-8-12)14(13(15)16)9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3,(H,15,16)/p-1 |
| CAS-szám |
7469-83-2 |
| EINECS |
231-266-8 |
| Molekuláris szerkezete |
|
| Olvadáspont |
172-177℃ |
| Forráspont |
389.7°C at 760 mmHg |
| Gyulladáspont |
145.8°C |
| Gőznyomás |
9E-07mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|
