ChemNet > CAS > 7472-43-7 6-Benzoylhexanoic acid
7472-43-7 6-Benzoylhexanoic acid
| termék neve |
6-Benzoylhexanoic acid |
| Angol név |
6-Benzoylhexanoic acid; 7-Oxo-7-phenylheptanoic acid; 7-Oxo-7-phenyl-heptanoic acid; 6-Benzoyl hexanoic Acid |
| MF |
C13H16O3 |
| Molekulatömeg |
220.2643 |
| InChI |
InChI=1/C13H16O3/c14-12(11-7-3-1-4-8-11)9-5-2-6-10-13(15)16/h1,3-4,7-8H,2,5-6,9-10H2,(H,15,16) |
| CAS-szám |
7472-43-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.111g/cm3 |
| Forráspont |
396°C at 760 mmHg |
| Törésmutató |
1.528 |
| Gyulladáspont |
207.4°C |
| Gőznyomás |
5.57E-07mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
