ChemNet > CAS > 74772-17-1 3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid
74772-17-1 3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid
termék neve |
3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid |
Angol név |
3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid; |
MF |
C9H7NO2S |
Molekulatömeg |
193.2224 |
InChI |
InChI=1/C9H7NO2S/c11-9(12)8-7(3-6-13-8)10-4-1-2-5-10/h1-6H,(H,11,12) |
CAS-szám |
74772-17-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.37g/cm3 |
Olvadáspont |
174℃ |
Forráspont |
377.3°C at 760 mmHg |
Törésmutató |
1.669 |
Gyulladáspont |
182°C |
Gőznyomás |
2.31E-06mmHg at 25°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|