75-27-4 Bromodichloromethane
termék neve |
Bromodichloromethane |
Angol név |
Bromodichloromethane; FC-20B1 |
MF |
CHBrCl2 |
Molekulatömeg |
163.8286 |
InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
CAS-szám |
75-27-4 |
EINECS |
200-856-7 |
Molekuláris szerkezete |
|
Sűrűség |
2.013g/cm3 |
Olvadáspont |
-55℃ |
Forráspont |
89.7°C at 760 mmHg |
Törésmutató |
1.503 |
Gyulladáspont |
1.3°C |
Gőznyomás |
65.3mmHg at 25°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|