ChemNet > CAS > 75129-74-7 4-Nitrophenoxyacetic acid hydrazide
75129-74-7 4-Nitrophenoxyacetic acid hydrazide
termék neve |
4-Nitrophenoxyacetic acid hydrazide |
Angol név |
4-Nitrophenoxyacetic acid hydrazide;Acetic acid, (4-nitrophenoxy)-, hydrazide; 2-(4-nitrophenoxy)acetohydrazide |
MF |
C8H9N3O4 |
Molekulatömeg |
211.1748 |
InChI |
InChI=1/C8H9N3O4/c9-10-8(12)5-15-7-3-1-6(2-4-7)11(13)14/h1-4H,5,9H2,(H,10,12) |
CAS-szám |
75129-74-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.394g/cm3 |
Forráspont |
511.9°C at 760 mmHg |
Törésmutató |
1.592 |
Gyulladáspont |
263.4°C |
Gőznyomás |
1.35E-10mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|