ChemNet > CAS > 7605-25-6 Ethyl (phenylthio)acetate
7605-25-6 Ethyl (phenylthio)acetate
termék neve |
Ethyl (phenylthio)acetate |
Angol név |
Ethyl (phenylthio)acetate; Ethyl 2-(phenylthio)acetate; ethyl (phenylsulfanyl)acetate; 2-(phenylsulfanyl)butanoic acid |
MF |
C10H12O2S |
Molekulatömeg |
196.2661 |
InChI |
InChI=1/C10H12O2S/c1-2-9(10(11)12)13-8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,11,12) |
CAS-szám |
7605-25-6 |
Molekuláris szerkezete |
|
Sűrűség |
1.18g/cm3 |
Forráspont |
330.3°C at 760 mmHg |
Törésmutató |
1.579 |
Gyulladáspont |
153.5°C |
Gőznyomás |
6.74E-05mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|