ChemNet > CAS > 7730-20-3 6-Fluoro-DL-tryptophan
7730-20-3 6-Fluoro-DL-tryptophan
termék neve |
6-Fluoro-DL-tryptophan |
Angol név |
6-Fluoro-DL-tryptophan; 6-Fluoro-DL-tryptophane; 2-Amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid; 6-fluoro-L-tryptophan; 6-fluoro-D-tryptophan |
MF |
C11H11FN2O2 |
Molekulatömeg |
222.2156 |
InChI |
InChI=1/C11H11FN2O2/c12-7-1-2-8-6(3-9(13)11(15)16)5-14-10(8)4-7/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m1/s1 |
CAS-szám |
7730-20-3 |
EINECS |
231-788-6 |
Molekuláris szerkezete |
|
Sűrűség |
1.442g/cm3 |
Olvadáspont |
280-28500℃ |
Forráspont |
450.7°C at 760 mmHg |
Törésmutató |
1.673 |
Gyulladáspont |
226.4°C |
Gőznyomás |
6.54E-09mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|