ChemNet > CAS > 782-17-2 2-(4-Fluorophenyl)indole
782-17-2 2-(4-Fluorophenyl)indole
| termék neve |
2-(4-Fluorophenyl)indole |
| Angol név |
2-(4-Fluorophenyl)indole; 2-(naphth-2-yl)-1h-indole; 2-(4-fluorophenyl)-1H-indole; 6-(4-fluorophenyl)-1H-indole |
| MF |
C14H10FN |
| Molekulatömeg |
211.2343 |
| InChI |
InChI=1/C14H10FN/c15-13-5-3-10(4-6-13)12-2-1-11-7-8-16-14(11)9-12/h1-9,16H |
| CAS-szám |
782-17-2 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.233g/cm3 |
| Olvadáspont |
190-192℃ |
| Forráspont |
389.094°C at 760 mmHg |
| Törésmutató |
1.658 |
| Gyulladáspont |
189.118°C |
| Gőznyomás |
0mmHg at 25°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
