ChemNet > CAS > 79-35-6 1,1-dichloro-2,2-difluoroethylene
79-35-6 1,1-dichloro-2,2-difluoroethylene
| termék neve |
1,1-dichloro-2,2-difluoroethylene |
| Angol név |
1,1-dichloro-2,2-difluoroethylene; FC-1112a; 1-chloro-1,2,2-trifluoroethene |
| MF |
C2Cl2F2 |
| Molekulatömeg |
132.9242 |
| InChI |
InChI=1/C2Cl2F2/c3-1(4)2(5)6 |
| CAS-szám |
79-35-6 |
| EINECS |
201-198-3 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.503g/cm3 |
| Forráspont |
17.3°C at 760 mmHg |
| Törésmutató |
1.392 |
| Gőznyomás |
999mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R23:Toxic by inhalation.;
R36/38:Irritating to eyes and skin.;
|
| Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S9:Keep container in a well-ventilated place.;
|
|
