ChemNet > CAS > 81067-38-1 1-Bromo-2,3,5-trichlorobenzene
81067-38-1 1-Bromo-2,3,5-trichlorobenzene
| termék neve |
1-Bromo-2,3,5-trichlorobenzene |
| Angol név |
1-Bromo-2,3,5-trichlorobenzene; 2,3,5-Trichlorobromobenzene |
| MF |
C6H2BrCl3 |
| Molekulatömeg |
260.3431 |
| InChI |
InChI=1/C6H2BrCl3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H |
| CAS-szám |
81067-38-1 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.84g/cm3 |
| Olvadáspont |
58-61℃ |
| Forráspont |
270.8°C at 760 mmHg |
| Törésmutató |
1.603 |
| Gyulladáspont |
129.3°C |
| Gőznyomás |
0.0111mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
