ChemNet > CAS > 81074-81-9 5-(dimethylaminomethyl)furfuryl alcohol hydrochlo
81074-81-9 5-(dimethylaminomethyl)furfuryl alcohol hydrochlo
| termék neve |
5-(dimethylaminomethyl)furfuryl alcohol hydrochlo |
| Angol név |
5-(dimethylaminomethyl)furfuryl alcohol hydrochlo; 5-(Dimethylaminomethyl)furfuryl alcohol hydrochloride; {5-[(dimethylamino)methyl]furan-2-yl}methanol hydrochloride |
| MF |
C8H14ClNO2 |
| Molekulatömeg |
191.6553 |
| InChI |
InChI=1/C8H13NO2.ClH/c1-9(2)5-7-3-4-8(6-10)11-7;/h3-4,10H,5-6H2,1-2H3;1H |
| CAS-szám |
81074-81-9 |
| EINECS |
279-686-0 |
| Molekuláris szerkezete |
|
| Olvadáspont |
122-125℃ |
| Forráspont |
217.7°C at 760 mmHg |
| Gyulladáspont |
85.5°C |
| Gőznyomás |
0.0762mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
