ChemNet > CAS > 828-00-2 2,6-dimethyl-1,3-dioxan-4-ol acetate
828-00-2 2,6-dimethyl-1,3-dioxan-4-ol acetate
termék neve |
2,6-dimethyl-1,3-dioxan-4-ol acetate |
Angol név |
2,6-dimethyl-1,3-dioxan-4-ol acetate; 2,6-Dimethyl-1,3-dioxan-4-ol acetate,mixture of cis and trans; 2,6-dimethyl-1,3-dioxan-4-yl acetate |
MF |
C8H14O4 |
Molekulatömeg |
174.1944 |
InChI |
InChI=1/C8H14O4/c1-5-4-8(11-6(2)9)12-7(3)10-5/h5,7-8H,4H2,1-3H3 |
CAS-szám |
828-00-2 |
EINECS |
212-579-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.08g/cm3 |
Forráspont |
212.3°C at 760 mmHg |
Törésmutató |
1.44 |
Gyulladáspont |
83.3°C |
Gőznyomás |
0.174mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
|
|