ChemNet > CAS > 83-24-9 2,5-Dimethyl-1-phenylpyrrole
83-24-9 2,5-Dimethyl-1-phenylpyrrole
| termék neve |
2,5-Dimethyl-1-phenylpyrrole |
| Angol név |
2,5-Dimethyl-1-phenylpyrrole;1H-Pyrrole, 2,5-dimethyl-1-phenyl-; NSC 163170; 2,5-Dimethyl-1-phenyl-1H-pyrrole; Pyrrole, 2,5-dimethyl-1-phenyl- (8CI); 1-cyclohexyl-2,5-dimethyl-1H-pyrrole; 2,5-dimethyl-1-phenylpyrrolidine |
| MF |
C12H17N |
| Molekulatömeg |
175.2701 |
| InChI |
InChI=1/C12H17N/c1-10-8-9-11(2)13(10)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3 |
| CAS-szám |
83-24-9 |
| EINECS |
201-461-2 |
| Molekuláris szerkezete |
|
| Sűrűség |
0.952g/cm3 |
| Olvadáspont |
50-51℃ |
| Forráspont |
257.7°C at 760 mmHg |
| Törésmutató |
1.519 |
| Gyulladáspont |
100.2°C |
| Gőznyomás |
0.0143mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
