87-52-5 Gramine
termék neve |
Gramine |
Angol név |
Gramine; 3-(Dimethylaminomethyl)indole; (1H-Indol-3-ylmethyl)-dimethyl-amine |
MF |
C11H14N2 |
Molekulatömeg |
174.2423 |
InChI |
InChI=1/C11H14N2/c1-13(2)8-9-7-12-11-6-4-3-5-10(9)11/h3-7,12H,8H2,1-2H3 |
CAS-szám |
87-52-5 |
EINECS |
201-749-8 |
Molekuláris szerkezete |
|
Sűrűség |
1.099g/cm3 |
Olvadáspont |
131-139℃ |
Forráspont |
293.9°C at 760 mmHg |
Törésmutató |
1.63 |
Gyulladáspont |
131.5°C |
Vízben való oldhatóság |
PRACTICALLY INSOLUBLE |
Gőznyomás |
0.00168mmHg at 25°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36:Irritating to eyes.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S46:If swallowed, seek medical advice immediately and show this container or label.;
|
|