ChemNet > CAS > 89793-11-3 Methyl-2-chloro-6-methylpyrimidine-4-carboxylate
89793-11-3 Methyl-2-chloro-6-methylpyrimidine-4-carboxylate
| termék neve |
Methyl-2-chloro-6-methylpyrimidine-4-carboxylate |
| Angol név |
Methyl-2-chloro-6-methylpyrimidine-4-carboxylate; Methyl 2-chloro-6-methylpyrimidine-4-carboxylate |
| MF |
C7H7ClN2O2 |
| Molekulatömeg |
186.5957 |
| InChI |
InChI=1/C7H7ClN2O2/c1-4-3-5(6(11)12-2)10-7(8)9-4/h3H,1-2H3 |
| CAS-szám |
89793-11-3 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.314g/cm3 |
| Olvadáspont |
107℃ |
| Forráspont |
306.5°C at 760 mmHg |
| Törésmutató |
1.53 |
| Gyulladáspont |
139.2°C |
| Gőznyomás |
0.000768mmHg at 25°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
