9005-84-9 Soluble Starch
termék neve |
Soluble Starch |
Angol név |
Soluble Starch; Starch; starch from maize; starch potato soluble; starch hydrolyzed for electrophoresis*from potato; starch potato hydrolyzed for*electrophoresis; Starch, Soluble, Corn (1.01257); Starch, Soluble GR, Corn (1.01252); Starch, soluble; Starch from potatoes; Starch soluble; Pregelatinized Starch |
MF |
C12H22O11 |
Molekulatömeg |
342.2948 |
InChI |
InChI=1/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11+,12-/m1/s1 |
CAS-szám |
9005-84-9 |
EINECS |
232-686-4 |
Molekuláris szerkezete |
|
Sűrűség |
1.5 |
Olvadáspont |
256-258℃ |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|