ChemNet > CAS > 9010-77-9 Ethylene/acrylic acid copolymer
9010-77-9 Ethylene/acrylic acid copolymer
| termék neve |
Ethylene/acrylic acid copolymer |
| Angol név |
Ethylene/acrylic acid copolymer; Poly(ethylene-co-acrylic acid); Ethylene-acrylic acid resin (90/10; prop-2-enoic acid - ethene (1:1); Ethylene acrylic acid copolymer; EAA |
| MF |
C5H8O2 |
| Molekulatömeg |
100.1158 |
| InChI |
InChI=1/C3H4O2.C2H4/c1-2-3(4)5;1-2/h2H,1H2,(H,4,5);1-2H2 |
| CAS-szám |
9010-77-9 |
| Molekuláris szerkezete |
|
| Olvadáspont |
87-101℃ |
| Forráspont |
141°C at 760 mmHg |
| Gyulladáspont |
61.6°C |
| Gőznyomás |
3.42mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|
