101-17-7 3-Chlorodiphenylamine
| Nama produk |
3-Chlorodiphenylamine |
| Nama bahasa Inggris |
3-Chlorodiphenylamine; Benzenamine, 3-chloro-N-phenyl-; 3-chloro-N-phenylaniline; 3-Chloro-N-phenyl-benzenamine; N-(3-chlorophenyl)aniline |
| MF |
C12H10ClN |
| Berat Molekul |
203.6675 |
| InChI |
InChI=1/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
| CAS NO |
101-17-7 |
| EINECS |
202-922-0 |
| Struktur Molekul |
|
| Kepadatan |
1.216g/cm3 |
| Titik didih |
337.8°C at 760 mmHg |
| Indeks bias |
1.642 |
| Titik nyala |
147.4°C |
| Tekanan uap |
0.000102mmHg at 25°C |
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|