ChemNet > CAS > 1016-05-3 Dibenzothiophene sulfone
1016-05-3 Dibenzothiophene sulfone
Nama produk |
Dibenzothiophene sulfone |
Nama bahasa Inggris |
Dibenzothiophene sulfone; Dibenzothiophene-5,5-dioxide; dibenzo[b,d]thiophene 5,5-dioxide |
MF |
C12H8O2S |
Berat Molekul |
216.2557 |
InChI |
InChI=1/C12H8O2S/c13-15(14)11-7-3-1-5-9(11)10-6-2-4-8-12(10)15/h1-8H |
CAS NO |
1016-05-3 |
EINECS |
213-805-9 |
Struktur Molekul |
|
Kepadatan |
1.396g/cm3 |
Titik lebur |
231-236℃ |
Titik didih |
422.2°C at 760 mmHg |
Indeks bias |
1.675 |
Titik nyala |
275.7°C |
Tekanan uap |
6.03E-07mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|