ChemNet > CAS > 102170-56-9 2-Bromo-6-methyl-4-nitroaniline
102170-56-9 2-Bromo-6-methyl-4-nitroaniline
Nama produk |
2-Bromo-6-methyl-4-nitroaniline |
Nama bahasa Inggris |
2-Bromo-6-methyl-4-nitroaniline; |
MF |
C7H7BrN2O2 |
Berat Molekul |
231.0467 |
InChI |
InChI=1/C7H7BrN2O2/c1-4-2-5(10(11)12)3-6(8)7(4)9/h2-3H,9H2,1H3 |
CAS NO |
102170-56-9 |
Struktur Molekul |
|
Kepadatan |
1.698g/cm3 |
Titik lebur |
177-181℃ |
Titik didih |
366°C at 760 mmHg |
Indeks bias |
1.648 |
Titik nyala |
175.2°C |
Tekanan uap |
1.51E-05mmHg at 25°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|