ChemNet > CAS > 10241-97-1 5-methylindole-2-carboxylic acid
10241-97-1 5-methylindole-2-carboxylic acid
| Nama produk |
5-methylindole-2-carboxylic acid |
| Nama bahasa Inggris |
5-methylindole-2-carboxylic acid; 5-methyl-1H-indole-2-carboxylic acid |
| MF |
C10H9NO2 |
| Berat Molekul |
175.184 |
| InChI |
InChI=1/C10H9NO2/c1-6-2-3-8-7(4-6)5-9(11-8)10(12)13/h2-5,11H,1H3,(H,12,13) |
| CAS NO |
10241-97-1 |
| Struktur Molekul |
|
| Kepadatan |
1.34g/cm3 |
| Titik didih |
421.2°C at 760 mmHg |
| Indeks bias |
1.696 |
| Titik nyala |
208.5°C |
| Tekanan uap |
7.58E-08mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
