ChemNet > CAS > 10401-11-3 3-Hydroxyphenylacetylene
10401-11-3 3-Hydroxyphenylacetylene
Nama produk |
3-Hydroxyphenylacetylene |
Nama bahasa Inggris |
3-Hydroxyphenylacetylene; 3-Ethynylphenol |
MF |
C8H6O |
Berat Molekul |
118.1326 |
InChI |
InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
CAS NO |
10401-11-3 |
Struktur Molekul |
|
Kepadatan |
1.12g/cm3 |
Titik didih |
230.9°C at 760 mmHg |
Indeks bias |
1.589 |
Titik nyala |
106.1°C |
Tekanan uap |
0.0424mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|