ChemNet > CAS > 10546-65-3 2,6-Dibromo-4-isopropylaniline
10546-65-3 2,6-Dibromo-4-isopropylaniline
| Nama produk |
2,6-Dibromo-4-isopropylaniline |
| Nama bahasa Inggris |
2,6-Dibromo-4-isopropylaniline; 2,6-Dibromo-4-n-propylaniline; 2,6-dibromo-4-(propan-2-yl)aniline; 2,6-dibromo-4-(1-methylethyl)-Benzenamine |
| MF |
C9H11Br2N |
| Berat Molekul |
292.9983 |
| InChI |
InChI=1/C9H11Br2N/c1-5(2)6-3-7(10)9(12)8(11)4-6/h3-5H,12H2,1-2H3 |
| CAS NO |
10546-65-3 |
| Struktur Molekul |
|
| Kepadatan |
1.682g/cm3 |
| Titik didih |
310.6°C at 760 mmHg |
| Indeks bias |
1.605 |
| Titik nyala |
141.6°C |
| Tekanan uap |
0.000595mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
