ChemNet > CAS > 1072-12-4 Glyoxal dithiosemicarbazone
1072-12-4 Glyoxal dithiosemicarbazone
Nama produk |
Glyoxal dithiosemicarbazone |
Sinonim |
; Bis glioksal(thiosemicarbazone); dithiosemicarbazone etanedial; (1Z,2Z)-ethanedial dithiosemicarbazone |
Nama bahasa Inggris |
Glyoxal dithiosemicarbazone; Glyoxal bis(thiosemicarbazone); ethanedial dithiosemicarbazone; (1Z,2Z)-ethanedial dithiosemicarbazone |
MF |
C4H8N6S2 |
Berat Molekul |
204.2765 |
InChI |
InChI=1/C4H8N6S2/c5-3(11)9-7-1-2-8-10-4(6)12/h1-2H,(H3,5,9,11)(H3,6,10,12)/b7-1-,8-2- |
CAS NO |
1072-12-4 |
Struktur Molekul |
|
Kepadatan |
1.61g/cm3 |
Titik didih |
384.6°C at 760 mmHg |
Indeks bias |
1.75 |
Titik nyala |
186.4°C |
Tekanan uap |
4.03E-06mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R20/22:Harmful by inhalation and if swallowed.;
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|