ChemNet > CAS > 1075-35-0 5-Chloro-2-methylindole
1075-35-0 5-Chloro-2-methylindole
| Nama produk |
5-Chloro-2-methylindole |
| Nama bahasa Inggris |
5-Chloro-2-methylindole;5-chloro-2-methyl-1H-indole |
| MF |
C9H8ClN |
| Berat Molekul |
165.6195 |
| InChI |
InChI=1/C9H8ClN/c1-6-4-7-5-8(10)2-3-9(7)11-6/h2-5,11H,1H3 |
| CAS NO |
1075-35-0 |
| EINECS |
214-052-9 |
| Struktur Molekul |
|
| Kepadatan |
1.273g/cm3 |
| Titik lebur |
112-117℃ |
| Titik didih |
302.7°C at 760 mmHg |
| Indeks bias |
1.663 |
| Titik nyala |
165.3°C |
| Tekanan uap |
0.00175mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|
