ChemNet > CAS > 110-42-9 Methyl caprate
110-42-9 Methyl caprate
| Nama produk |
Methyl caprate |
| Nama bahasa Inggris |
Methyl caprate; Methyl decanoate; Capric acid methyl ester~Decanoic acid methyl ester~Methyl decanoate; METHYLE N-CAPRINATE |
| MF |
C11H22O2 |
| Berat Molekul |
186.2912 |
| InChI |
InChI=1/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3 |
| CAS NO |
110-42-9 |
| EINECS |
203-766-6 |
| Struktur Molekul |
|
| Kepadatan |
0.872g/cm3 |
| Titik lebur |
-11--14℃ |
| Titik didih |
224°C at 760 mmHg |
| Indeks bias |
1.426 |
| Titik nyala |
94.4°C |
| Tekanan uap |
0.0934mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|
