ChemNet > CAS > 110888-15-8 4-Chloro-3-fluorobenzonitrile
110888-15-8 4-Chloro-3-fluorobenzonitrile
| Nama produk |
4-Chloro-3-fluorobenzonitrile |
| Nama bahasa Inggris |
4-Chloro-3-fluorobenzonitrile; BUTTPARK 45\01-08; 3-Fluoro-4-Chlorobenzonitrile; 4-chloro-3-fluorobenzontrile |
| MF |
C7H3ClFN |
| Berat Molekul |
155.5568 |
| InChI |
InChI=1/C7H3ClFN/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
| CAS NO |
110888-15-8 |
| Struktur Molekul |
|
| Kepadatan |
1.33g/cm3 |
| Titik lebur |
79-81°C |
| Titik didih |
214°C at 760 mmHg |
| Indeks bias |
1.536 |
| Titik nyala |
83.2°C |
| Tekanan uap |
0.159mmHg at 25°C |
| Simbol bahaya |
 T,Xi:;
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|
