ChemNet > CAS > 111787-91-8 (2-metil-5-fenil-3-furil)metanol
111787-91-8 (2-metil-5-fenil-3-furil)metanol
| Nama produk |
(2-metil-5-fenil-3-furil)metanol |
| Sinonim |
(2-metil-5-fenilfuran-3-yl) metanol |
| Nama bahasa Inggris |
(2-methyl-5-phenyl-3-furyl)methanol;(2-methyl-5-phenylfuran-3-yl)methanol |
| MF |
C12H12O2 |
| Berat Molekul |
188.2225 |
| InChI |
InChI=1/C12H12O2/c1-9-11(8-13)7-12(14-9)10-5-3-2-4-6-10/h2-7,13H,8H2,1H3 |
| CAS NO |
111787-91-8 |
| Struktur Molekul |
|
| Kepadatan |
1.123g/cm3 |
| Titik lebur |
22℃ |
| Titik didih |
233.9°C at 760 mmHg |
| Indeks bias |
1.562 |
| Titik nyala |
95.2°C |
| Tekanan uap |
0.0302mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
