ChemNet > CAS > 112399-50-5 2-Bromo-5-fluorobenzyl bromide
112399-50-5 2-Bromo-5-fluorobenzyl bromide
| Nama produk |
2-Bromo-5-fluorobenzyl bromide |
| Nama bahasa Inggris |
2-Bromo-5-fluorobenzyl bromide; 2-Bromo-5-fluorobenzylbromide; 1-bromo-2-(bromomethyl)-4-fluorobenzene; 5-Fluoro-2-Bromobenzyl Bromide |
| MF |
C7H5Br2F |
| Berat Molekul |
267.921 |
| InChI |
InChI=1/C7H5Br2F/c8-4-5-3-6(10)1-2-7(5)9/h1-3H,4H2 |
| CAS NO |
112399-50-5 |
| Struktur Molekul |
|
| Kepadatan |
1.923g/cm3 |
| Titik didih |
245.4°C at 760 mmHg |
| Indeks bias |
1.583 |
| Titik nyala |
102.2°C |
| Tekanan uap |
0.045mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
