ChemNet > CAS > 1124-08-9 1,4-Diiodo-2,5-dimethylbenzene
1124-08-9 1,4-Diiodo-2,5-dimethylbenzene
| Nama produk |
1,4-Diiodo-2,5-dimethylbenzene |
| Nama bahasa Inggris |
1,4-Diiodo-2,5-dimethylbenzene; 2,5-Diiodo-p-xylene
|
| MF |
C8H8I2 |
| Berat Molekul |
357.9581 |
| InChI |
InChI=1/C8H8I2/c1-5-3-8(10)6(2)4-7(5)9/h3-4H,1-2H3 |
| CAS NO |
1124-08-9 |
| Struktur Molekul |
|
| Kepadatan |
2.154g/cm3 |
| Titik lebur |
103℃ |
| Titik didih |
306.2°C at 760 mmHg |
| Indeks bias |
1.665 |
| Titik nyala |
147.6°C |
| Tekanan uap |
0.00142mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
