ChemNet > CAS > 1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
| Nama produk |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
| Nama bahasa Inggris |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane; |
| MF |
C7H11FO2 |
| Berat Molekul |
146.1594 |
| InChI |
InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
| CAS NO |
1171-47-7 |
| Struktur Molekul |
|
| Kepadatan |
1.159g/cm3 |
| Titik didih |
227.566°C at 760 mmHg |
| Indeks bias |
1.454 |
| Titik nyala |
91.429°C |
| Tekanan uap |
0.028mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
