ChemNet > CAS > 1191-41-9 ethyl linolenate
1191-41-9 ethyl linolenate
| Nama produk |
ethyl linolenate |
| Nama bahasa Inggris |
ethyl linolenate; Linolenic acid ethyl ester; 9,12,15-Octadecatrienoic acid ethyl ester; ethyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate; ethyl (9E,12E,15E)-octadeca-9,12,15-trienoate |
| MF |
C20H34O2 |
| Berat Molekul |
306.4828 |
| InChI |
InChI=1/C20H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h5-6,8-9,11-12H,3-4,7,10,13-19H2,1-2H3/b6-5+,9-8+,12-11+ |
| CAS NO |
1191-41-9 |
| EINECS |
214-734-6 |
| Struktur Molekul |
|
| Kepadatan |
0.893g/cm3 |
| Titik didih |
374.4°C at 760 mmHg |
| Indeks bias |
1.475 |
| Titik nyala |
100.7°C |
| Tekanan uap |
8.35E-06mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|
