120-50-3 Isobutyl benzoate

Nama produk	Isobutyl benzoate
Nama bahasa Inggris	Isobutyl benzoate; Isobutyl benzoate, (Benzoic acid isobutyl ester); Benzoic acid isobutyl ester
MF	C₁₁H₁₄O₂
Berat Molekul	178.23
InChI	InChI=1/C11H14O2/c1-9(2)8-13-11(12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3
CAS NO	120-50-3
EINECS	204-401-3
Struktur Molekul
Kepadatan	0.999
Titik didih	240-242℃
Indeks bias	1.493-1.495
Titik nyala	96℃
Simbol bahaya
Kode Risiko
Keselamatan Deskripsi	S24/25:Avoid contact with skin and eyes.;